dipentyl butanedioate


amyl butanedioate; amyl succinate; n-amyl succinate; di-n-amyl succinate; diamyl succinate; dipentyl butanedioate; dipentyl succinate; succinic acid amyl ester; succinic acid dipentyl ester
Links:📏 NIST
CAS RN:[645-69-2]
Formula:C14H26O4; 258.36 g/mol
InChiKey:JYCRKSLWSLBYLT-UHFFFAOYSA-N
SMILES:CCCCCOC(=O)CCC(=O)OCCCCC
Molecular structure of dipentyl butanedioate
Use:flavor in alcoholic beverage formulations
Density:0.960 g/mL
Molar volume:269.1 mL/mol
Refractive index:1.434
Molecular refractive power:70.08 mL/mol
Melting point:-11 °C
Surface tension:29.87 dyn/cm

Isomers

bis(2-methylbutyl) butanedioate
Molecular structure of bis(2-methylbutyl) butanedioate
bis(3-methylbutyl) butanedioate
Molecular structure of bis(3-methylbutyl) butanedioate
bis(2-methylpropyl) hexanedioate
Molecular structure of bis(2-methylpropyl) hexanedioate
dibutyl hexanedioate
Molecular structure of dibutyl hexanedioate
dibutyl 2-propylpropanedioate
Molecular structure of dibutyl 2-propylpropanedioate
diethyl decanedioate
Molecular structure of diethyl decanedioate
diethyl 2-ethyl-2-(3-methylbutyl)propanedioate
Molecular structure of diethyl 2-ethyl-2-(3-methylbutyl)propanedioate
diethyl heptylmalonate
Molecular structure of diethyl heptylmalonate
dihexyl oxalate
Molecular structure of dihexyl oxalate
dimethyl dodecanedioate
Molecular structure of dimethyl dodecanedioate
dipentyl butanedioate
Molecular structure of dipentyl butanedioate
dipropyl octanedioate
Molecular structure of dipropyl octanedioate
dipropyl 2-pentylpropanedioate
Molecular structure of dipropyl 2-pentylpropanedioate
6-(1-ethyl-1-hydroxypropyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
Molecular structure of 6-(1-ethyl-1-hydroxypropyl)-2,2,6-trimethyltetrahydro-2H-pyran-3-carboxylic acid
tetradecanedioic acid
Molecular structure of tetradecanedioic acid